About N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide
N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide (PubChem CID 145077823) has the molecular formula C12H19FN2O
and a molecular weight of 226.29 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide.
Molecular Properties
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide |
| PubChem CID | 145077823 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide |
| SMILES | C[C@@H](CN)NC(=O)CCC1=C(F)CCC=C1 |
| InChI | InChI=1S/C12H19FN2O/c1-9(8-14)15-12(16)7-6-10-4-2-3-5-11(10)13/h2,4,9H,3,5-8,14H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | ASIHXXIKFBYQAP-VIFPVBQESA-N |
| XLogP | 1.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide?
The IUPAC name of N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide (CID 145077823) is N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide.
What is the SMILES notation for N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide?
The canonical SMILES for N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide is C[C@@H](CN)NC(=O)CCC1=C(F)CCC=C1.
What is the InChIKey of N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide?
The InChIKey is ASIHXXIKFBYQAP-VIFPVBQESA-N. The full InChI is InChI=1S/C12H19FN2O/c1-9(8-14)15-12(16)7-6-10-4-2-3-5-11(10)13/h2,4,9H,3,5-8,14H2,1H3,(H,15,16)/t9-/m0/s1.
What are the key properties of N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide?
N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide has a molecular weight of 226.29 g/mol, XLogP of 1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-aminopropan-2-yl]-3-(2-fluorocyclohexa-1,5-dien-1-yl)propanamide is sourced from PubChem (CID 145077823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).