C26H43ClO9 — CID 145077837
chloro 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate (PubChem CID 145077837) has the molecular formula C26H43ClO9 and a molecular weight of 535.07 g/mol. Its IUPAC name is chloro 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate.
| Compound Name | chloro 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
|---|---|
| PubChem CID | 145077837 |
| Molecular Formula | C26H43ClO9 |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | chloro 9-[(E)-4-[(2S,3R,4R,5S)-3,4-dihydroxy-5-[[(2S,3S)-3-[(2S,3S)-3-hydroxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)OCl)C[C@@H]1OC[C@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H43ClO9/c1-16(13-23(30)33-11-9-7-5-4-6-8-10-22(29)36-27)12-20-25(32)24(31)19(15-34-20)14-21-26(35-21)17(2)18(3)28/h13,17-21,24-26,28,31-32H,4-12,14-15H2,1-3H3/b16-13+/t17-,18-,19-,20-,21-,24+,25-,26-/m0/s1 |
| InChIKey | YFEGICVSUSQQEW-HBBNESRFSA-N |
| XLogP | 3.20 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|