C21H25N5O3 — CID 145077882
4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid;N-cyclohexylpyrazin-2-amine (PubChem CID 145077882) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid;N-cyclohexylpyrazin-2-amine.
| Compound Name | 4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid;N-cyclohexylpyrazin-2-amine |
|---|---|
| PubChem CID | 145077882 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-amino-5-hydroxy-2-methylquinoline-3-carboxylic acid;N-cyclohexylpyrazin-2-amine |
| SMILES | Cc1nc2cccc(O)c2c(N)c1C(=O)O.c1cnc(NC2CCCCC2)cn1 |
| InChI | InChI=1S/C11H10N2O3.C10H15N3/c1-5-8(11(15)16)10(12)9-6(13-5)3-2-4-7(9)14;1-2-4-9(5-3-1)13-10-8-11-6-7-12-10/h2-4,14H,1H3,(H2,12,13)(H,15,16);6-9H,1-5H2,(H,12,13) |
| InChIKey | MJEPVPRDRXARGH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |