C15H16ClN5O — CID 145077932
7-chloro-5-methyl-N-(2,3,4,5-tetrahydro-1-benzofuran-6-ylmethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 145077932) has the molecular formula C15H16ClN5O and a molecular weight of 317.78 g/mol. Its IUPAC name is 7-chloro-5-methyl-N-(2,3,4,5-tetrahydro-1-benzofuran-6-ylmethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-chloro-5-methyl-N-(2,3,4,5-tetrahydro-1-benzofuran-6-ylmethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 145077932 |
| Molecular Formula | C15H16ClN5O |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 7-chloro-5-methyl-N-(2,3,4,5-tetrahydro-1-benzofuran-6-ylmethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Cc1cc(Cl)n2nc(NCC3=CC4=C(CCO4)CC3)nc2n1 |
| InChI | InChI=1S/C15H16ClN5O/c1-9-6-13(16)21-15(18-9)19-14(20-21)17-8-10-2-3-11-4-5-22-12(11)7-10/h6-7H,2-5,8H2,1H3,(H,17,20) |
| InChIKey | VWRKLLGZOLSETI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |