C15H19FN2 — CID 145078015
6-[2-(3-fluorophenyl)ethyl]-4-methylpyridin-2-amine;methane (PubChem CID 145078015) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is 6-[2-(3-fluorophenyl)ethyl]-4-methylpyridin-2-amine;methane.
| Compound Name | 6-[2-(3-fluorophenyl)ethyl]-4-methylpyridin-2-amine;methane |
|---|---|
| PubChem CID | 145078015 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 6-[2-(3-fluorophenyl)ethyl]-4-methylpyridin-2-amine;methane |
| SMILES | C.Cc1cc(N)nc(CCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C14H15FN2.CH4/c1-10-7-13(17-14(16)8-10)6-5-11-3-2-4-12(15)9-11;/h2-4,7-9H,5-6H2,1H3,(H2,16,17);1H4 |
| InChIKey | LCXCDGVYXWFCAM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |