C17H20N6O — CID 145078642
5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde;2-methanimidoyl-4-N-methylbenzene-1,4-diamine (PubChem CID 145078642) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde;2-methanimidoyl-4-N-methylbenzene-1,4-diamine.
| Compound Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde;2-methanimidoyl-4-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 145078642 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde;2-methanimidoyl-4-N-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(C)n2ncc(C=O)c2n1.[H]/N=C/c1cc(NC)ccc1N |
| InChI | InChI=1S/C9H9N3O.C8H11N3/c1-6-3-7(2)12-9(11-6)8(5-13)4-10-12;1-11-7-2-3-8(10)6(4-7)5-9/h3-5H,1-2H3;2-5,9,11H,10H2,1H3/b;9-5+ |
| InChIKey | LWLIFTGBBKKUJP-DTDKZNDQSA-N |
| XLogP | 2.47 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|