C20H22FN3O — CID 145079164
8-fluoro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine (PubChem CID 145079164) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is 8-fluoro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine.
| Compound Name | 8-fluoro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 145079164 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 8-fluoro-N-[(3-methylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
| SMILES | Cc1cccc(C/N=C2\Nc3c(F)cccc3NC23CCOCC3)c1 |
| InChI | InChI=1S/C20H22FN3O/c1-14-4-2-5-15(12-14)13-22-19-20(8-10-25-11-9-20)24-17-7-3-6-16(21)18(17)23-19/h2-7,12,24H,8-11,13H2,1H3,(H,22,23) |
| InChIKey | RBMYRMBWUVSCTB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|