C21H28N4 — CID 145079170
N-benzylspiro[1,4-dihydropyrido[3,4-b]pyrazine-2,1'-cyclohexane]-3-imine;ethane (PubChem CID 145079170) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-benzylspiro[1,4-dihydropyrido[3,4-b]pyrazine-2,1'-cyclohexane]-3-imine;ethane.
| Compound Name | N-benzylspiro[1,4-dihydropyrido[3,4-b]pyrazine-2,1'-cyclohexane]-3-imine;ethane |
|---|---|
| PubChem CID | 145079170 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | N-benzylspiro[1,4-dihydropyrido[3,4-b]pyrazine-2,1'-cyclohexane]-3-imine;ethane |
| SMILES | CC.c1ccc(C/N=C2\Nc3cnccc3NC23CCCCC3)cc1 |
| InChI | InChI=1S/C19H22N4.C2H6/c1-3-7-15(8-4-1)13-21-18-19(10-5-2-6-11-19)23-16-9-12-20-14-17(16)22-18;1-2/h1,3-4,7-9,12,14,23H,2,5-6,10-11,13H2,(H,21,22);1-2H3 |
| InChIKey | OWVNWFXAOBJUTD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|