C23H30N4S — CID 145079217
N-[(2Z)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine (PubChem CID 145079217) has the molecular formula C23H30N4S and a molecular weight of 394.59 g/mol. Its IUPAC name is N-[(2Z)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine.
| Compound Name | N-[(2Z)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 145079217 |
| Molecular Formula | C23H30N4S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | N-[(2Z)-2-(1-pyrrolidin-1-ylethenyl)penta-2,4-dienyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
| SMILES | C=C/C=C(/C/N=C1\Nc2ccccc2NC12CCSCC2)C(=C)N1CCCC1 |
| InChI | InChI=1S/C23H30N4S/c1-3-8-19(18(2)27-13-6-7-14-27)17-24-22-23(11-15-28-16-12-23)26-21-10-5-4-9-20(21)25-22/h3-5,8-10,26H,1-2,6-7,11-17H2,(H,24,25)/b19-8- |
| InChIKey | NNJVNYIUWXGSDB-UWVJOHFNSA-N |
| XLogP | 4.91 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|