About ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine
ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine (PubChem CID 145080157) has the molecular formula C20H24N2
and a molecular weight of 292.43 g/mol. Its IUPAC name is ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine.
Molecular Properties
| Compound Name | ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine |
| PubChem CID | 145080157 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine |
| SMILES | C=C.C=C/C(=C\C)c1ccc(C2C=C/C=C\C(=C)NN2)cc1 |
| InChI | InChI=1S/C18H20N2.C2H4/c1-4-15(5-2)16-10-12-17(13-11-16)18-9-7-6-8-14(3)19-20-18;1-2/h4-13,18-20H,1,3H2,2H3;1-2H2/b8-6-,9-7?,15-5+; |
| InChIKey | WJCUNGNHMVYSBH-QJYOBVOMSA-N |
| XLogP | 4.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine?
The IUPAC name of ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine (CID 145080157) is ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine.
What is the SMILES notation for ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine?
The canonical SMILES for ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine is C=C.C=C/C(=C\C)c1ccc(C2C=C/C=C\C(=C)NN2)cc1.
What is the InChIKey of ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine?
The InChIKey is WJCUNGNHMVYSBH-QJYOBVOMSA-N. The full InChI is InChI=1S/C18H20N2.C2H4/c1-4-15(5-2)16-10-12-17(13-11-16)18-9-7-6-8-14(3)19-20-18;1-2/h4-13,18-20H,1,3H2,2H3;1-2H2/b8-6-,9-7?,15-5+;.
What are the key properties of ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine?
ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine has a molecular weight of 292.43 g/mol, XLogP of 4.85, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;(6Z)-8-methylidene-3-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]-2,3-dihydro-1H-diazocine is sourced from PubChem (CID 145080157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).