About 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide
4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide (PubChem CID 145080742) has the molecular formula C17H27ClN4O
and a molecular weight of 338.88 g/mol. Its IUPAC name is 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide.
Molecular Properties
| Compound Name | 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide |
| PubChem CID | 145080742 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide |
| SMILES | CC.Cc1ccc(Cl)c2cnn(C)c12.NC(=O)CN1CCCC1 |
| InChI | InChI=1S/C9H9ClN2.C6H12N2O.C2H6/c1-6-3-4-8(10)7-5-11-12(2)9(6)7;7-6(9)5-8-3-1-2-4-8;1-2/h3-5H,1-2H3;1-5H2,(H2,7,9);1-2H3 |
| InChIKey | OUBIYTBMQICAAO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide?
The IUPAC name of 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide (CID 145080742) is 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide.
What is the SMILES notation for 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide?
The canonical SMILES for 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide is CC.Cc1ccc(Cl)c2cnn(C)c12.NC(=O)CN1CCCC1.
What is the InChIKey of 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide?
The InChIKey is OUBIYTBMQICAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2.C6H12N2O.C2H6/c1-6-3-4-8(10)7-5-11-12(2)9(6)7;7-6(9)5-8-3-1-2-4-8;1-2/h3-5H,1-2H3;1-5H2,(H2,7,9);1-2H3.
What are the key properties of 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide?
4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide has a molecular weight of 338.88 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,7-dimethylindazole;ethane;2-pyrrolidin-1-ylacetamide is sourced from PubChem (CID 145080742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).