C9H7N3 — CID 145080935
2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynamine (PubChem CID 145080935) has the molecular formula C9H7N3 and a molecular weight of 157.18 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynamine.
| Compound Name | 2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynamine |
|---|---|
| PubChem CID | 145080935 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-(1H-pyrrolo[2,3-b]pyridin-5-yl)ethynamine |
| SMILES | NC#Cc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H7N3/c10-3-1-7-5-8-2-4-11-9(8)12-6-7/h2,4-6H,10H2,(H,11,12) |
| InChIKey | HLMLKFYDSHHJBX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|