C20H37N3O4 — CID 145080952
tert-butyl 2-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-[methyl(prop-2-ynyl)amino]ethyl]amino]ethylamino]acetate (PubChem CID 145080952) has the molecular formula C20H37N3O4 and a molecular weight of 383.53 g/mol. Its IUPAC name is tert-butyl 2-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-[methyl(prop-2-ynyl)amino]ethyl]amino]ethylamino]acetate.
| Compound Name | tert-butyl 2-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-[methyl(prop-2-ynyl)amino]ethyl]amino]ethylamino]acetate |
|---|---|
| PubChem CID | 145080952 |
| Molecular Formula | C20H37N3O4 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | tert-butyl 2-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[2-[methyl(prop-2-ynyl)amino]ethyl]amino]ethylamino]acetate |
| SMILES | C#CCN(C)CCN(CCNCC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37N3O4/c1-9-11-22(8)13-14-23(16-18(25)27-20(5,6)7)12-10-21-15-17(24)26-19(2,3)4/h1,21H,10-16H2,2-8H3 |
| InChIKey | UIMSPWZRHPDMEP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|