C20H23N3O2 — CID 145081343
6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one;N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)formamide (PubChem CID 145081343) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one;N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)formamide.
| Compound Name | 6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one;N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)formamide |
|---|---|
| PubChem CID | 145081343 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one;N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)formamide |
| SMILES | Cn1ccc2cc[nH]c2c1=O.O=CNC1CCCCc2ccccc21 |
| InChI | InChI=1S/C12H15NO.C8H8N2O/c14-9-13-12-8-4-2-6-10-5-1-3-7-11(10)12;1-10-5-3-6-2-4-9-7(6)8(10)11/h1,3,5,7,9,12H,2,4,6,8H2,(H,13,14);2-5,9H,1H3 |
| InChIKey | BDXXXRHHVJUNTK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|