C24H29N3O2 — CID 145081408
N,2-dimethyl-N-(5-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-7-oxo-6-prop-2-enyl-1H-pyrrolo[2,3-c]pyridine-4-carboxamide;molecular hydrogen (PubChem CID 145081408) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N,2-dimethyl-N-(5-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-7-oxo-6-prop-2-enyl-1H-pyrrolo[2,3-c]pyridine-4-carboxamide;molecular hydrogen.
| Compound Name | N,2-dimethyl-N-(5-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-7-oxo-6-prop-2-enyl-1H-pyrrolo[2,3-c]pyridine-4-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 145081408 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N,2-dimethyl-N-(5-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-7-oxo-6-prop-2-enyl-1H-pyrrolo[2,3-c]pyridine-4-carboxamide;molecular hydrogen |
| SMILES | C=CCn1cc(C(=O)N(C)C2CCCc3c(C)cccc32)c2cc(C)[nH]c2c1=O.[H][H] |
| InChI | InChI=1S/C24H27N3O2.H2/c1-5-12-27-14-20(19-13-16(3)25-22(19)24(27)29)23(28)26(4)21-11-7-9-17-15(2)8-6-10-18(17)21;/h5-6,8,10,13-14,21,25H,1,7,9,11-12H2,2-4H3;1H |
| InChIKey | OMGIAEBRYYDOCB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|