C13H18FNO2 — CID 145081712
(2Z,4Z)-3-fluoro-2,6-dimethyl-1-morpholin-4-ylhepta-2,4,6-trien-1-one (PubChem CID 145081712) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is (2Z,4Z)-3-fluoro-2,6-dimethyl-1-morpholin-4-ylhepta-2,4,6-trien-1-one.
| Compound Name | (2Z,4Z)-3-fluoro-2,6-dimethyl-1-morpholin-4-ylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 145081712 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2Z,4Z)-3-fluoro-2,6-dimethyl-1-morpholin-4-ylhepta-2,4,6-trien-1-one |
| SMILES | C=C(C)/C=C\C(F)=C(/C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H18FNO2/c1-10(2)4-5-12(14)11(3)13(16)15-6-8-17-9-7-15/h4-5H,1,6-9H2,2-3H3/b5-4-,12-11- |
| InChIKey | PBRJUYJROBSOSE-NHTRZOJKSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|