About 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one
2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one (PubChem CID 145082196) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one.
Molecular Properties
| Compound Name | 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one |
| PubChem CID | 145082196 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one |
| SMILES | C=C(C)/C=C\C(=O)CC.C=c1ccc(=C)n1CCC |
| InChI | InChI=1S/C9H13N.C8H12O/c1-4-7-10-8(2)5-6-9(10)3;1-4-8(9)6-5-7(2)3/h5-6H,2-4,7H2,1H3;5-6H,2,4H2,1,3H3/b;6-5- |
| InChIKey | WDHXKJKCTXBETH-JXGYXAOLSA-N |
| XLogP | 2.82 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one?
The IUPAC name of 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one (CID 145082196) is 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one.
What is the SMILES notation for 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one?
The canonical SMILES for 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one is C=C(C)/C=C\C(=O)CC.C=c1ccc(=C)n1CCC.
What is the InChIKey of 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one?
The InChIKey is WDHXKJKCTXBETH-JXGYXAOLSA-N. The full InChI is InChI=1S/C9H13N.C8H12O/c1-4-7-10-8(2)5-6-9(10)3;1-4-8(9)6-5-7(2)3/h5-6H,2-4,7H2,1H3;5-6H,2,4H2,1,3H3/b;6-5-.
What are the key properties of 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one?
2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one has a molecular weight of 259.39 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylidene-1-propylpyrrole;(4Z)-6-methylhepta-4,6-dien-3-one is sourced from PubChem (CID 145082196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).