C19H21FN4S — CID 145082269
N-[[4-(2-fluoro-4-methylphenyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-amine (PubChem CID 145082269) has the molecular formula C19H21FN4S and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[[4-(2-fluoro-4-methylphenyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-amine.
| Compound Name | N-[[4-(2-fluoro-4-methylphenyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 145082269 |
| Molecular Formula | C19H21FN4S |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[[4-(2-fluoro-4-methylphenyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-ylsulfanyl)propan-1-amine |
| SMILES | Cc1ccc(-c2ccc(CNCCCSc3ncn[nH]3)cc2)c(F)c1 |
| InChI | InChI=1S/C19H21FN4S/c1-14-3-8-17(18(20)11-14)16-6-4-15(5-7-16)12-21-9-2-10-25-19-22-13-23-24-19/h3-8,11,13,21H,2,9-10,12H2,1H3,(H,22,23,24) |
| InChIKey | BMZWRPLLCYFYBG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|