C10H17N — CID 145082937
(4Z)-7-methyl-6-methylideneocta-4,7-dien-1-amine (PubChem CID 145082937) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (4Z)-7-methyl-6-methylideneocta-4,7-dien-1-amine.
| Compound Name | (4Z)-7-methyl-6-methylideneocta-4,7-dien-1-amine |
|---|---|
| PubChem CID | 145082937 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (4Z)-7-methyl-6-methylideneocta-4,7-dien-1-amine |
| SMILES | C=C(C)C(=C)/C=C\CCCN |
| InChI | InChI=1S/C10H17N/c1-9(2)10(3)7-5-4-6-8-11/h5,7H,1,3-4,6,8,11H2,2H3/b7-5- |
| InChIKey | LVOCLJDCCNFLJP-ALCCZGGFSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|