C38H36N2O — CID 145083028
N-[(3Z,5Z)-3-(2-methylphenyl)hepta-1,3,5-trien-4-yl]-9H-carbazol-3-amine;(1Z,3Z)-5-phenylhexa-1,3,5-trien-1-ol (PubChem CID 145083028) has the molecular formula C38H36N2O and a molecular weight of 536.72 g/mol. Its IUPAC name is N-[(3Z,5Z)-3-(2-methylphenyl)hepta-1,3,5-trien-4-yl]-9H-carbazol-3-amine;(1Z,3Z)-5-phenylhexa-1,3,5-trien-1-ol.
| Compound Name | N-[(3Z,5Z)-3-(2-methylphenyl)hepta-1,3,5-trien-4-yl]-9H-carbazol-3-amine;(1Z,3Z)-5-phenylhexa-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 145083028 |
| Molecular Formula | C38H36N2O |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | N-[(3Z,5Z)-3-(2-methylphenyl)hepta-1,3,5-trien-4-yl]-9H-carbazol-3-amine;(1Z,3Z)-5-phenylhexa-1,3,5-trien-1-ol |
| SMILES | C=C(/C=C\C=C/O)c1ccccc1.C=C/C(=C(\C=C/C)Nc1ccc2[nH]c3ccccc3c2c1)c1ccccc1C |
| InChI | InChI=1S/C26H24N2.C12H12O/c1-4-10-24(20(5-2)21-12-7-6-11-18(21)3)27-19-15-16-26-23(17-19)22-13-8-9-14-25(22)28-26;1-11(7-5-6-10-13)12-8-3-2-4-9-12/h4-17,27-28H,2H2,1,3H3;2-10,13H,1H2/b10-4-,24-20-;7-5-,10-6- |
| InChIKey | JDCJTSCVGWJISZ-LKTLPLRVSA-N |
| XLogP | 10.54 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|