C2H2F8O3S2 — CID 14508344
1,1,2-trifluoro-2-(pentafluoro-lambda6-sulfanyl)ethanesulfonic acid (PubChem CID 14508344) has the molecular formula C2H2F8O3S2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 1,1,2-trifluoro-2-(pentafluoro-lambda6-sulfanyl)ethanesulfonic acid.
| Compound Name | 1,1,2-trifluoro-2-(pentafluoro-lambda6-sulfanyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 14508344 |
| Molecular Formula | C2H2F8O3S2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 1,1,2-trifluoro-2-(pentafluoro-lambda6-sulfanyl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C2H2F8O3S2/c3-1(15(6,7,8,9)10)2(4,5)14(11,12)13/h1H,(H,11,12,13) |
| InChIKey | GWDDSOCBZJODEV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|