C13H23N3O2 — CID 145083687
ethane;2-methyl-N-(6-propan-2-yloxypyrazin-2-yl)propanamide (PubChem CID 145083687) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is ethane;2-methyl-N-(6-propan-2-yloxypyrazin-2-yl)propanamide.
| Compound Name | ethane;2-methyl-N-(6-propan-2-yloxypyrazin-2-yl)propanamide |
|---|---|
| PubChem CID | 145083687 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | ethane;2-methyl-N-(6-propan-2-yloxypyrazin-2-yl)propanamide |
| SMILES | CC.CC(C)Oc1cncc(NC(=O)C(C)C)n1 |
| InChI | InChI=1S/C11H17N3O2.C2H6/c1-7(2)11(15)14-9-5-12-6-10(13-9)16-8(3)4;1-2/h5-8H,1-4H3,(H,13,14,15);1-2H3 |
| InChIKey | WNEWFQIAWDWVIH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |