C23H22BrF3N6O — CID 145083790
N-(4-bromo-2-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;ethane (PubChem CID 145083790) has the molecular formula C23H22BrF3N6O and a molecular weight of 535.37 g/mol. Its IUPAC name is N-(4-bromo-2-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;ethane.
| Compound Name | N-(4-bromo-2-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;ethane |
|---|---|
| PubChem CID | 145083790 |
| Molecular Formula | C23H22BrF3N6O |
| Molecular Weight | 535.37 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | N-(4-bromo-2-pyridinyl)-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide;ethane |
| SMILES | CC.O=C(Nc1cc(Br)ccn1)N1c2nc(-c3ccnc(C(F)(F)F)c3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C21H16BrF3N6O.C2H6/c22-13-4-7-27-18(10-13)29-20(32)31-14-5-8-30(11-14)16-2-1-15(28-19(16)31)12-3-6-26-17(9-12)21(23,24)25;1-2/h1-4,6-7,9-10,14H,5,8,11H2,(H,27,29,32);1-2H3 |
| InChIKey | PMPXRGQFLKLWJW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.37 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |