C26H24F3N7OS — CID 145083791
N-[4-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]formamide;8-methyl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 145083791) has the molecular formula C26H24F3N7OS and a molecular weight of 539.59 g/mol. Its IUPAC name is N-[4-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]formamide;8-methyl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | N-[4-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]formamide;8-methyl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 145083791 |
| Molecular Formula | C26H24F3N7OS |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | N-[4-(2-methyl-1,3-thiazol-5-yl)-2-pyridinyl]formamide;8-methyl-5-[2-(trifluoromethyl)-4-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | CN1c2nc(-c3ccnc(C(F)(F)F)c3)ccc2N2CCC1C2.Cc1ncc(-c2ccnc(NC=O)c2)s1 |
| InChI | InChI=1S/C16H15F3N4.C10H9N3OS/c1-22-11-5-7-23(9-11)13-3-2-12(21-15(13)22)10-4-6-20-14(8-10)16(17,18)19;1-7-12-5-9(15-7)8-2-3-11-10(4-8)13-6-14/h2-4,6,8,11H,5,7,9H2,1H3;2-6H,1H3,(H,11,13,14) |
| InChIKey | IHCNSDGFKBAFSM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|