About 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol
2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol (PubChem CID 14508434) has the molecular formula C9H20OS2Si
and a molecular weight of 236.48 g/mol. Its IUPAC name is 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol |
| PubChem CID | 14508434 |
| Molecular Formula | C9H20OS2Si |
| Molecular Weight | 236.48 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol |
| SMILES | C[Si](C)(C)C1(CCO)SCCCS1 |
| InChI | InChI=1S/C9H20OS2Si/c1-13(2,3)9(5-6-10)11-7-4-8-12-9/h10H,4-8H2,1-3H3 |
| InChIKey | SHAAIBWOHUDRFJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol?
The IUPAC name of 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol (CID 14508434) is 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol.
What is the SMILES notation for 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol?
The canonical SMILES for 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol is C[Si](C)(C)C1(CCO)SCCCS1.
What is the InChIKey of 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol?
The InChIKey is SHAAIBWOHUDRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20OS2Si/c1-13(2,3)9(5-6-10)11-7-4-8-12-9/h10H,4-8H2,1-3H3.
What are the key properties of 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol?
2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol has a molecular weight of 236.48 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-trimethylsilyl-1,3-dithian-2-yl)ethanol is sourced from PubChem (CID 14508434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).