About N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide
N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide (PubChem CID 145084497) has the molecular formula C9H13N3O4
and a molecular weight of 227.22 g/mol. Its IUPAC name is N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide |
| PubChem CID | 145084497 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1cc(OCC(O)CO)ncn1 |
| InChI | InChI=1S/C9H13N3O4/c1-6(14)12-8-2-9(11-5-10-8)16-4-7(15)3-13/h2,5,7,13,15H,3-4H2,1H3,(H,10,11,12,14) |
| InChIKey | PVXJFTMIMBTNAF-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide?
The IUPAC name of N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide (CID 145084497) is N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide?
The canonical SMILES for N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide is CC(=O)Nc1cc(OCC(O)CO)ncn1.
What is the InChIKey of N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide?
The InChIKey is PVXJFTMIMBTNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c1-6(14)12-8-2-9(11-5-10-8)16-4-7(15)3-13/h2,5,7,13,15H,3-4H2,1H3,(H,10,11,12,14).
What are the key properties of N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide?
N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide has a molecular weight of 227.22 g/mol, XLogP of -0.83, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,3-dihydroxypropoxy)pyrimidin-4-yl]acetamide is sourced from PubChem (CID 145084497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).