C14H13FN4 — CID 145084662
5-(3-fluorophenyl)-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 145084662) has the molecular formula C14H13FN4 and a molecular weight of 256.28 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 5-(3-fluorophenyl)-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 145084662 |
| Molecular Formula | C14H13FN4 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 5-(3-fluorophenyl)-1,4,6,8-tetrazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Fc1cccc(-c2ncc3c(n2)NC2CCN3C2)c1 |
| InChI | InChI=1S/C14H13FN4/c15-10-3-1-2-9(6-10)13-16-7-12-14(18-13)17-11-4-5-19(12)8-11/h1-3,6-7,11H,4-5,8H2,(H,16,17,18) |
| InChIKey | DIQFFVPAIVQTHO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |