C39H29N4S+ — CID 145085186
12-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-1-ium-4-yl)phenyl]-6b,10a-dihydro-[1]benzothiolo[2,3-a]carbazole (PubChem CID 145085186) has the molecular formula C39H29N4S+ and a molecular weight of 585.76 g/mol. Its IUPAC name is 12-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-1-ium-4-yl)phenyl]-6b,10a-dihydro-[1]benzothiolo[2,3-a]carbazole.
| Compound Name | 12-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-1-ium-4-yl)phenyl]-6b,10a-dihydro-[1]benzothiolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 145085186 |
| Molecular Formula | C39H29N4S+ |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 12-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-1-ium-4-yl)phenyl]-6b,10a-dihydro-[1]benzothiolo[2,3-a]carbazole |
| SMILES | C1=CC2Sc3c(ccc4c5ccccc5n(-c5ccc(C6=NC(c7ccccc7)[NH2+]C(c7ccccc7)=N6)cc5)c34)C2C=C1 |
| InChI | InChI=1S/C39H28N4S/c1-3-11-25(12-4-1)37-40-38(26-13-5-2-6-14-26)42-39(41-37)27-19-21-28(22-20-27)43-33-17-9-7-15-29(33)31-23-24-32-30-16-8-10-18-34(30)44-36(32)35(31)43/h1-24,30,34,37H,(H,40,41,42)/p+1 |
| InChIKey | RJMBSTFGVGTABM-UHFFFAOYSA-O |
| XLogP | 7.94 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |