C10H9N5OS — CID 145085709
5-[5-(1-methylpyrazol-4-yl)furan-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 145085709) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is 5-[5-(1-methylpyrazol-4-yl)furan-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[5-(1-methylpyrazol-4-yl)furan-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 145085709 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 5-[5-(1-methylpyrazol-4-yl)furan-2-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | Cn1cc(-c2ccc(-c3nc(=S)[nH][nH]3)o2)cn1 |
| InChI | InChI=1S/C10H9N5OS/c1-15-5-6(4-11-15)7-2-3-8(16-7)9-12-10(17)14-13-9/h2-5H,1H3,(H2,12,13,14,17) |
| InChIKey | UWQGZLIDWLFUOF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|