C16H17N6O3+ — CID 145086016
3-amino-N-[(1-methoxypyridin-1-ium-3-yl)methyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide (PubChem CID 145086016) has the molecular formula C16H17N6O3+ and a molecular weight of 341.35 g/mol. Its IUPAC name is 3-amino-N-[(1-methoxypyridin-1-ium-3-yl)methyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(1-methoxypyridin-1-ium-3-yl)methyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 145086016 |
| Molecular Formula | C16H17N6O3+ |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-amino-N-[(1-methoxypyridin-1-ium-3-yl)methyl]-6-methyl-5-(1,3-oxazol-2-yl)pyrazine-2-carboxamide |
| SMILES | CO[n+]1cccc(CNC(=O)c2nc(C)c(-c3ncco3)nc2N)c1 |
| InChI | InChI=1S/C16H16N6O3/c1-10-12(16-18-5-7-25-16)21-14(17)13(20-10)15(23)19-8-11-4-3-6-22(9-11)24-2/h3-7,9H,8H2,1-2H3,(H2-,17,19,21,23)/p+1 |
| InChIKey | ZBUKLHPSWVOIEW-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|