C16H23FN2O2S — CID 145086230
N-[2-(4-fluorophenyl)ethyl]-2-[(Z)-3-methoxy-2-(methylamino)but-2-enyl]sulfanylacetamide (PubChem CID 145086230) has the molecular formula C16H23FN2O2S and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-[(Z)-3-methoxy-2-(methylamino)but-2-enyl]sulfanylacetamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-[(Z)-3-methoxy-2-(methylamino)but-2-enyl]sulfanylacetamide |
|---|---|
| PubChem CID | 145086230 |
| Molecular Formula | C16H23FN2O2S |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-[(Z)-3-methoxy-2-(methylamino)but-2-enyl]sulfanylacetamide |
| SMILES | CN/C(CSCC(=O)NCCc1ccc(F)cc1)=C(/C)OC |
| InChI | InChI=1S/C16H23FN2O2S/c1-12(21-3)15(18-2)10-22-11-16(20)19-9-8-13-4-6-14(17)7-5-13/h4-7,18H,8-11H2,1-3H3,(H,19,20)/b15-12- |
| InChIKey | YFMWQEVUZIZUST-QINSGFPZSA-N |
| XLogP | 2.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|