C23H52N2 — CID 145086421
ethane;2,2,4-trimethyl-4-N-(2,4,4,6,6-pentamethyloctan-2-yl)pentane-1,4-diamine (PubChem CID 145086421) has the molecular formula C23H52N2 and a molecular weight of 356.68 g/mol. Its IUPAC name is ethane;2,2,4-trimethyl-4-N-(2,4,4,6,6-pentamethyloctan-2-yl)pentane-1,4-diamine.
| Compound Name | ethane;2,2,4-trimethyl-4-N-(2,4,4,6,6-pentamethyloctan-2-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 145086421 |
| Molecular Formula | C23H52N2 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 356.41 |
| IUPAC Name | ethane;2,2,4-trimethyl-4-N-(2,4,4,6,6-pentamethyloctan-2-yl)pentane-1,4-diamine |
| SMILES | CC.CCC(C)(C)CC(C)(C)CC(C)(C)NC(C)(C)CC(C)(C)CN |
| InChI | InChI=1S/C21H46N2.C2H6/c1-12-17(2,3)13-18(4,5)14-20(8,9)23-21(10,11)15-19(6,7)16-22;1-2/h23H,12-16,22H2,1-11H3;1-2H3 |
| InChIKey | YQFNKQAFYLUAFJ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |