C23H27N3O2S — CID 145086489
ethane;16-(2-oxo-2-pyrrolidin-1-ylethyl)-12-thia-14,16-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),3,6,13(18),14-hexaen-17-one (PubChem CID 145086489) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is ethane;16-(2-oxo-2-pyrrolidin-1-ylethyl)-12-thia-14,16-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),3,6,13(18),14-hexaen-17-one.
| Compound Name | ethane;16-(2-oxo-2-pyrrolidin-1-ylethyl)-12-thia-14,16-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),3,6,13(18),14-hexaen-17-one |
|---|---|
| PubChem CID | 145086489 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | ethane;16-(2-oxo-2-pyrrolidin-1-ylethyl)-12-thia-14,16-diazatetracyclo[9.7.0.02,8.013,18]octadeca-1(11),2(8),3,6,13(18),14-hexaen-17-one |
| SMILES | CC.O=C(Cn1cnc2sc3c(c2c1=O)C1=C(C=CCC=C1)CC3)N1CCCC1 |
| InChI | InChI=1S/C21H21N3O2S.C2H6/c25-17(23-10-4-5-11-23)12-24-13-22-20-19(21(24)26)18-15-7-3-1-2-6-14(15)8-9-16(18)27-20;1-2/h2-3,6-7,13H,1,4-5,8-12H2;1-2H3 |
| InChIKey | RZDAIEDJYFOCIK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |