C49H74O12 — CID 145087158
[2-(3-decoxy-3-oxopropyl)-2-methyl-1,3-dioxolan-4-yl]methyl benzoate;[2-methyl-2-[3-(7-methyloctoxy)-3-oxopropyl]-1,3-dioxolan-4-yl]methyl benzoate (PubChem CID 145087158) has the molecular formula C49H74O12 and a molecular weight of 855.12 g/mol. Its IUPAC name is [2-(3-decoxy-3-oxopropyl)-2-methyl-1,3-dioxolan-4-yl]methyl benzoate;[2-methyl-2-[3-(7-methyloctoxy)-3-oxopropyl]-1,3-dioxolan-4-yl]methyl benzoate.
| Compound Name | [2-(3-decoxy-3-oxopropyl)-2-methyl-1,3-dioxolan-4-yl]methyl benzoate;[2-methyl-2-[3-(7-methyloctoxy)-3-oxopropyl]-1,3-dioxolan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 145087158 |
| Molecular Formula | C49H74O12 |
| Molecular Weight | 855.12 g/mol |
| Exact Mass | 854.52 |
| IUPAC Name | [2-(3-decoxy-3-oxopropyl)-2-methyl-1,3-dioxolan-4-yl]methyl benzoate;[2-methyl-2-[3-(7-methyloctoxy)-3-oxopropyl]-1,3-dioxolan-4-yl]methyl benzoate |
| SMILES | CC(C)CCCCCCOC(=O)CCC1(C)OCC(COC(=O)c2ccccc2)O1.CCCCCCCCCCOC(=O)CCC1(C)OCC(COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C25H38O6.C24H36O6/c1-3-4-5-6-7-8-9-13-18-28-23(26)16-17-25(2)30-20-22(31-25)19-29-24(27)21-14-11-10-12-15-21;1-19(2)11-7-4-5-10-16-27-22(25)14-15-24(3)29-18-21(30-24)17-28-23(26)20-12-8-6-9-13-20/h10-12,14-15,22H,3-9,13,16-20H2,1-2H3;6,8-9,12-13,19,21H,4-5,7,10-11,14-18H2,1-3H3 |
| InChIKey | MBMOOFSCUWDIBQ-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.12 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|