C19H22F2N4O2 — CID 145087395
(3,4-difluorophenyl)-[8-[hydroxy(methylamino)methyl]-3,4,4-trimethyl-2,5-dihydropyrazolo[3,4-d]azepin-6-yl]methanone (PubChem CID 145087395) has the molecular formula C19H22F2N4O2 and a molecular weight of 376.41 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[8-[hydroxy(methylamino)methyl]-3,4,4-trimethyl-2,5-dihydropyrazolo[3,4-d]azepin-6-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[8-[hydroxy(methylamino)methyl]-3,4,4-trimethyl-2,5-dihydropyrazolo[3,4-d]azepin-6-yl]methanone |
|---|---|
| PubChem CID | 145087395 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (3,4-difluorophenyl)-[8-[hydroxy(methylamino)methyl]-3,4,4-trimethyl-2,5-dihydropyrazolo[3,4-d]azepin-6-yl]methanone |
| SMILES | CNC(O)C1=CN(C(=O)c2ccc(F)c(F)c2)CC(C)(C)c2c1n[nH]c2C |
| InChI | InChI=1S/C19H22F2N4O2/c1-10-15-16(24-23-10)12(17(26)22-4)8-25(9-19(15,2)3)18(27)11-5-6-13(20)14(21)7-11/h5-8,17,22,26H,9H2,1-4H3,(H,23,24) |
| InChIKey | QGPRWUBAXLBBIU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|