About 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine
6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine (PubChem CID 145087498) has the molecular formula C8H7BrN2S
and a molecular weight of 243.13 g/mol. Its IUPAC name is 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine |
| PubChem CID | 145087498 |
| Molecular Formula | C8H7BrN2S |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine |
| SMILES | Cc1ncnc2sc(Br)c(C)c12 |
| InChI | InChI=1S/C8H7BrN2S/c1-4-6-5(2)10-3-11-8(6)12-7(4)9/h3H,1-2H3 |
| InChIKey | KEHNIYIVKBFJJA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine?
The IUPAC name of 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine (CID 145087498) is 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine?
The canonical SMILES for 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine is Cc1ncnc2sc(Br)c(C)c12.
What is the InChIKey of 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine?
The InChIKey is KEHNIYIVKBFJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2S/c1-4-6-5(2)10-3-11-8(6)12-7(4)9/h3H,1-2H3.
What are the key properties of 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine?
6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine has a molecular weight of 243.13 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,5-dimethylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 145087498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).