About ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one
ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one (PubChem CID 145087562) has the molecular formula C12H26F3NO
and a molecular weight of 257.34 g/mol. Its IUPAC name is ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one.
Molecular Properties
| Compound Name | ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one |
| PubChem CID | 145087562 |
| Molecular Formula | C12H26F3NO |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one |
| SMILES | CC.CC.CNC(CC(C)C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C8H14F3NO.2C2H6/c1-5(8(9,10)11)4-7(12-3)6(2)13;2*1-2/h5,7,12H,4H2,1-3H3;2*1-2H3 |
| InChIKey | CGPSVMPFJYNXRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one?
The IUPAC name of ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one (CID 145087562) is ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one.
What is the SMILES notation for ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one?
The canonical SMILES for ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one is CC.CC.CNC(CC(C)C(F)(F)F)C(C)=O.
What is the InChIKey of ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one?
The InChIKey is CGPSVMPFJYNXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO.2C2H6/c1-5(8(9,10)11)4-7(12-3)6(2)13;2*1-2/h5,7,12H,4H2,1-3H3;2*1-2H3.
What are the key properties of ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one?
ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one has a molecular weight of 257.34 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6,6,6-trifluoro-5-methyl-3-(methylamino)hexan-2-one is sourced from PubChem (CID 145087562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).