C39H44N8O6S4 — CID 145088107
N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine;bis(2-methylbenzenesulfonate) (PubChem CID 145088107) has the molecular formula C39H44N8O6S4 and a molecular weight of 849.10 g/mol. Its IUPAC name is N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine;bis(2-methylbenzenesulfonate).
| Compound Name | N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine;bis(2-methylbenzenesulfonate) |
|---|---|
| PubChem CID | 145088107 |
| Molecular Formula | C39H44N8O6S4 |
| Molecular Weight | 849.10 g/mol |
| Exact Mass | 848.23 |
| IUPAC Name | N,N'-bis[2-methyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]phenyl]propane-1,3-diamine;bis(2-methylbenzenesulfonate) |
| SMILES | Cc1cc(/N=N/c2scc[n+]2C)ccc1NCCCNc1ccc(/N=N/c2scc[n+]2C)cc1C.Cc1ccccc1S(=O)(=O)[O-].Cc1ccccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C25H28N8S2.2C7H8O3S/c1-18-16-20(28-30-24-32(3)12-14-34-24)6-8-22(18)26-10-5-11-27-23-9-7-21(17-19(23)2)29-31-25-33(4)13-15-35-25;2*1-6-4-2-3-5-7(6)11(8,9)10/h6-9,12-17H,5,10-11H2,1-4H3;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | FAVCSNYWASVNSO-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 195.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.10 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|