C22H24N8O — CID 145088877
[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[8-(3-methylimidazo[1,5-a]pyrazin-1-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]methanone (PubChem CID 145088877) has the molecular formula C22H24N8O and a molecular weight of 416.49 g/mol. Its IUPAC name is [2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[8-(3-methylimidazo[1,5-a]pyrazin-1-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]methanone.
| Compound Name | [2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[8-(3-methylimidazo[1,5-a]pyrazin-1-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]methanone |
|---|---|
| PubChem CID | 145088877 |
| Molecular Formula | C22H24N8O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[8-(3-methylimidazo[1,5-a]pyrazin-1-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]methanone |
| SMILES | [H]/N=C\C=N/Nc1ccccc1C(=O)N1CC2CCC(C1)N2c1nc(C)n2ccncc12 |
| InChI | InChI=1S/C22H24N8O/c1-15-26-21(20-12-24-10-11-29(15)20)30-16-6-7-17(30)14-28(13-16)22(31)18-4-2-3-5-19(18)27-25-9-8-23/h2-5,8-12,16-17,23,27H,6-7,13-14H2,1H3/b23-8-,25-9- |
| InChIKey | FBGFAQLCJWLSCZ-FVQOSQDWSA-N |
| XLogP | 2.58 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|