About ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane
ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane (PubChem CID 145089047) has the molecular formula C18H38F2
and a molecular weight of 292.50 g/mol. Its IUPAC name is ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane.
Molecular Properties
| Compound Name | ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane |
| PubChem CID | 145089047 |
| Molecular Formula | C18H38F2 |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane |
| SMILES | CC.CCC.CCCC(CC)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H24F2.C3H8.C2H6/c1-3-5-11(4-2)10-12-6-8-13(14,15)9-7-12;1-3-2;1-2/h11-12H,3-10H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | XTRWECIBIGZOGI-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane?
The IUPAC name of ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane (CID 145089047) is ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane.
What is the SMILES notation for ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane?
The canonical SMILES for ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane is CC.CCC.CCCC(CC)CC1CCC(F)(F)CC1.
What is the InChIKey of ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane?
The InChIKey is XTRWECIBIGZOGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F2.C3H8.C2H6/c1-3-5-11(4-2)10-12-6-8-13(14,15)9-7-12;1-3-2;1-2/h11-12H,3-10H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane?
ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane has a molecular weight of 292.50 g/mol, XLogP of 7.47, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(2-ethylpentyl)-1,1-difluorocyclohexane;propane is sourced from PubChem (CID 145089047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).