About 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one
5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one (PubChem CID 145090056) has the molecular formula C7H12N4O3
and a molecular weight of 200.20 g/mol. Its IUPAC name is 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
| PubChem CID | 145090056 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1cnc(NCC(O)CO)[nH]c1=O |
| InChI | InChI=1S/C7H12N4O3/c8-5-2-10-7(11-6(5)14)9-1-4(13)3-12/h2,4,12-13H,1,3,8H2,(H2,9,10,11,14) |
| InChIKey | QUSVLNHMPAINRF-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one?
The IUPAC name of 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one (CID 145090056) is 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one?
The canonical SMILES for 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one is Nc1cnc(NCC(O)CO)[nH]c1=O.
What is the InChIKey of 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one?
The InChIKey is QUSVLNHMPAINRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O3/c8-5-2-10-7(11-6(5)14)9-1-4(13)3-12/h2,4,12-13H,1,3,8H2,(H2,9,10,11,14).
What are the key properties of 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one?
5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one has a molecular weight of 200.20 g/mol, XLogP of -1.88, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one is sourced from PubChem (CID 145090056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).