C18H32N2O2S — CID 145090132
N-[2-(3-hydroxypropylamino)ethyl]-4-phenylbutanamide;propane-2-thiol (PubChem CID 145090132) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylamino)ethyl]-4-phenylbutanamide;propane-2-thiol.
| Compound Name | N-[2-(3-hydroxypropylamino)ethyl]-4-phenylbutanamide;propane-2-thiol |
|---|---|
| PubChem CID | 145090132 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-[2-(3-hydroxypropylamino)ethyl]-4-phenylbutanamide;propane-2-thiol |
| SMILES | CC(C)S.O=C(CCCc1ccccc1)NCCNCCCO |
| InChI | InChI=1S/C15H24N2O2.C3H8S/c18-13-5-10-16-11-12-17-15(19)9-4-8-14-6-2-1-3-7-14;1-3(2)4/h1-3,6-7,16,18H,4-5,8-13H2,(H,17,19);3-4H,1-2H3 |
| InChIKey | JUBSWRVWHHSKQP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|