About 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone
1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone (PubChem CID 145090222) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone |
| PubChem CID | 145090222 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone |
| SMILES | CC(=O)C1=NNN(C)N1 |
| InChI | InChI=1S/C4H8N4O/c1-3(9)4-5-7-8(2)6-4/h7H,1-2H3,(H,5,6) |
| InChIKey | FRLPUNFXBGDONL-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone?
The IUPAC name of 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone (CID 145090222) is 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone.
What is the SMILES notation for 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone?
The canonical SMILES for 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone is CC(=O)C1=NNN(C)N1.
What is the InChIKey of 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone?
The InChIKey is FRLPUNFXBGDONL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O/c1-3(9)4-5-7-8(2)6-4/h7H,1-2H3,(H,5,6).
What are the key properties of 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone?
1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone has a molecular weight of 128.13 g/mol, XLogP of -1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-1,3-dihydrotetrazol-5-yl)ethanone is sourced from PubChem (CID 145090222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).