C28H38N4O2 — CID 145091030
acetaldehyde;4-(cyclopropylmethylamino)-N'-[3-[3-(1-hydroxypropyl)phenyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine-5-carboximidamide (PubChem CID 145091030) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is acetaldehyde;4-(cyclopropylmethylamino)-N'-[3-[3-(1-hydroxypropyl)phenyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine-5-carboximidamide.
| Compound Name | acetaldehyde;4-(cyclopropylmethylamino)-N'-[3-[3-(1-hydroxypropyl)phenyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 145091030 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | acetaldehyde;4-(cyclopropylmethylamino)-N'-[3-[3-(1-hydroxypropyl)phenyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine-5-carboximidamide |
| SMILES | CC=O.CCC(O)c1cccc(-c2cccc(/N=C(\N)C3=C(NCC4CC4)CCN(C)C3)c2)c1 |
| InChI | InChI=1S/C26H34N4O.C2H4O/c1-3-25(31)21-8-4-6-19(14-21)20-7-5-9-22(15-20)29-26(27)23-17-30(2)13-12-24(23)28-16-18-10-11-18;1-2-3/h4-9,14-15,18,25,28,31H,3,10-13,16-17H2,1-2H3,(H2,27,29);2H,1H3 |
| InChIKey | GADANJJSDCOVOH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|