C17H19N5 — CID 145091106
acetylene;1,4-dimethyl-7-(1-methylpyrazol-4-yl)-2,3-dihydroquinoxaline-6-carbonitrile (PubChem CID 145091106) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is acetylene;1,4-dimethyl-7-(1-methylpyrazol-4-yl)-2,3-dihydroquinoxaline-6-carbonitrile.
| Compound Name | acetylene;1,4-dimethyl-7-(1-methylpyrazol-4-yl)-2,3-dihydroquinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 145091106 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | acetylene;1,4-dimethyl-7-(1-methylpyrazol-4-yl)-2,3-dihydroquinoxaline-6-carbonitrile |
| SMILES | C#C.CN1CCN(C)c2cc(-c3cnn(C)c3)c(C#N)cc21 |
| InChI | InChI=1S/C15H17N5.C2H2/c1-18-4-5-19(2)15-7-13(11(8-16)6-14(15)18)12-9-17-20(3)10-12;1-2/h6-7,9-10H,4-5H2,1-3H3;1-2H |
| InChIKey | OZAZVRCQEGPRBN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|