About (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine
(1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine (PubChem CID 145091561) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine |
| PubChem CID | 145091561 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine |
| SMILES | C=C/C(=C\N)c1ccc(C)c(CCC)c1 |
| InChI | InChI=1S/C14H19N/c1-4-6-13-9-14(8-7-11(13)3)12(5-2)10-15/h5,7-10H,2,4,6,15H2,1,3H3/b12-10+ |
| InChIKey | WBDLWXDPVOWOON-ZRDIBKRKSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine?
The IUPAC name of (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine (CID 145091561) is (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine?
The canonical SMILES for (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine is C=C/C(=C\N)c1ccc(C)c(CCC)c1.
What is the InChIKey of (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine?
The InChIKey is WBDLWXDPVOWOON-ZRDIBKRKSA-N. The full InChI is InChI=1S/C14H19N/c1-4-6-13-9-14(8-7-11(13)3)12(5-2)10-15/h5,7-10H,2,4,6,15H2,1,3H3/b12-10+.
What are the key properties of (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine?
(1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine has a molecular weight of 201.31 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-2-(4-methyl-3-propylphenyl)buta-1,3-dien-1-amine is sourced from PubChem (CID 145091561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).