C28H47F3N2O5S — CID 145092472
1-[(3R)-3-[(1S,2R,5R,7S,8R,11R,12S,15R,16R)-8-ethyl-5,9-dihydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]butyl]-3-(trifluoromethylsulfonyl)urea (PubChem CID 145092472) has the molecular formula C28H47F3N2O5S and a molecular weight of 580.75 g/mol. Its IUPAC name is 1-[(3R)-3-[(1S,2R,5R,7S,8R,11R,12S,15R,16R)-8-ethyl-5,9-dihydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]butyl]-3-(trifluoromethylsulfonyl)urea.
| Compound Name | 1-[(3R)-3-[(1S,2R,5R,7S,8R,11R,12S,15R,16R)-8-ethyl-5,9-dihydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]butyl]-3-(trifluoromethylsulfonyl)urea |
|---|---|
| PubChem CID | 145092472 |
| Molecular Formula | C28H47F3N2O5S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 1-[(3R)-3-[(1S,2R,5R,7S,8R,11R,12S,15R,16R)-8-ethyl-5,9-dihydroxy-2,16-dimethyl-15-tetracyclo[9.7.0.02,7.012,16]octadecanyl]butyl]-3-(trifluoromethylsulfonyl)urea |
| SMILES | CC[C@H]1C(O)C[C@H]2[C@H](CC[C@]3(C)[C@@H]([C@H](C)CCNC(=O)NS(=O)(=O)C(F)(F)F)CC[C@@H]23)[C@@]2(C)CC[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C28H47F3N2O5S/c1-5-18-23-14-17(34)8-11-27(23,4)22-9-12-26(3)20(6-7-21(26)19(22)15-24(18)35)16(2)10-13-32-25(36)33-39(37,38)28(29,30)31/h16-24,34-35H,5-15H2,1-4H3,(H2,32,33,36)/t16-,17-,18-,19-,20-,21+,22+,23+,24?,26-,27-/m1/s1 |
| InChIKey | XENUXWRHYVBZKL-VOUSUXSVSA-N |
| XLogP | 5.18 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |