C16H20N4O2 — CID 145092540
8-[(Z)-2-amino-4-iminopent-2-en-3-yl]-9-hydroxy-3-propylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 145092540) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 8-[(Z)-2-amino-4-iminopent-2-en-3-yl]-9-hydroxy-3-propylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 8-[(Z)-2-amino-4-iminopent-2-en-3-yl]-9-hydroxy-3-propylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 145092540 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 8-[(Z)-2-amino-4-iminopent-2-en-3-yl]-9-hydroxy-3-propylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | [H]/N=C(C)/C(=C(/C)N)c1ccn2c(=O)c(CCC)cnc2c1O |
| InChI | InChI=1S/C16H20N4O2/c1-4-5-11-8-19-15-14(21)12(6-7-20(15)16(11)22)13(9(2)17)10(3)18/h6-8,17,21H,4-5,18H2,1-3H3/b13-10+,17-9+ |
| InChIKey | PIIWTPMXVFDJHP-OVZWPINUSA-N |
| XLogP | 2.08 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|