About 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one
2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one (PubChem CID 145092727) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one |
| PubChem CID | 145092727 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one |
| SMILES | CCc1nc2c(c(=O)[nH]1)=CC=CCC=2 |
| InChI | InChI=1S/C11H12N2O/c1-2-10-12-9-7-5-3-4-6-8(9)11(14)13-10/h3-4,6-7H,2,5H2,1H3,(H,12,13,14) |
| InChIKey | SKKZUHWGDKZXGU-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one?
The IUPAC name of 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one (CID 145092727) is 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one.
What is the SMILES notation for 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one?
The canonical SMILES for 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one is CCc1nc2c(c(=O)[nH]1)=CC=CCC=2.
What is the InChIKey of 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one?
The InChIKey is SKKZUHWGDKZXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-10-12-9-7-5-3-4-6-8(9)11(14)13-10/h3-4,6-7H,2,5H2,1H3,(H,12,13,14).
What are the key properties of 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one?
2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one has a molecular weight of 188.23 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,8-dihydrocyclohepta[d]pyrimidin-4-one is sourced from PubChem (CID 145092727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).