About ethane;1-(furan-3-yl)ethanone;methane
ethane;1-(furan-3-yl)ethanone;methane (PubChem CID 145092753) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is ethane;1-(furan-3-yl)ethanone;methane.
Molecular Properties
| Compound Name | ethane;1-(furan-3-yl)ethanone;methane |
| PubChem CID | 145092753 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | ethane;1-(furan-3-yl)ethanone;methane |
| SMILES | C.CC.CC(=O)c1ccoc1 |
| InChI | InChI=1S/C6H6O2.C2H6.CH4/c1-5(7)6-2-3-8-4-6;1-2;/h2-4H,1H3;1-2H3;1H4 |
| InChIKey | DAMZDWMYTWUQJH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-(furan-3-yl)ethanone;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(furan-3-yl)ethanone;methane?
The IUPAC name of ethane;1-(furan-3-yl)ethanone;methane (CID 145092753) is ethane;1-(furan-3-yl)ethanone;methane.
What is the SMILES notation for ethane;1-(furan-3-yl)ethanone;methane?
The canonical SMILES for ethane;1-(furan-3-yl)ethanone;methane is C.CC.CC(=O)c1ccoc1.
What is the InChIKey of ethane;1-(furan-3-yl)ethanone;methane?
The InChIKey is DAMZDWMYTWUQJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H6.CH4/c1-5(7)6-2-3-8-4-6;1-2;/h2-4H,1H3;1-2H3;1H4.
What are the key properties of ethane;1-(furan-3-yl)ethanone;methane?
ethane;1-(furan-3-yl)ethanone;methane has a molecular weight of 156.22 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(furan-3-yl)ethanone;methane is sourced from PubChem (CID 145092753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).